(Z)-octadec-11-enoic acid


(Z)-octadec-11-enoic acid; cis-vaccenic acid
CAS RN:[506-17-2]
Formula:C18H34O2; 282.47 g/mol
InChiKey:UWHZIFQPPBDJPM-FPLPWBNLSA-N
SMILES:CCCCCCC=C/CCCCCCCCCC(O)=O
Molecular structure of (Z)-octadec-11-enoic acid
Density:0.887 g/mL
Molar volume:318.5 mL/mol
Melting point:15 °C
Boiling point:150 °C

Isomers

(Z)-octadec-11-enoic acid
Molecular structure of (Z)-octadec-11-enoic acid
(E)-octadec-9-enoic acid
Molecular structure of (E)-octadec-9-enoic acid
(Z)-octadec-9-enoic acid
Molecular structure of (Z)-octadec-9-enoic acid
petroselinic acid
Molecular structure of petroselinic acid
tetradecyl 2-methylprop-2-enoate
Molecular structure of tetradecyl 2-methylprop-2-enoate
vaccenic acid
Molecular structure of vaccenic acid